About (3E)-5-(2,2-difluoropent-4-enyl)-3-(1-iodoethylidene)-2-methylidenethiophene
(3E)-5-(2,2-difluoropent-4-enyl)-3-(1-iodoethylidene)-2-methylidenethiophene (PubChem CID 134364774) has the molecular formula C12H13F2IS
and a molecular weight of 354.20 g/mol. Its IUPAC name is (3E)-5-(2,2-difluoropent-4-enyl)-3-(1-iodoethylidene)-2-methylidenethiophene.
Molecular Properties
| Compound Name | (3E)-5-(2,2-difluoropent-4-enyl)-3-(1-iodoethylidene)-2-methylidenethiophene |
| PubChem CID | 134364774 |
| Molecular Formula | C12H13F2IS |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | (3E)-5-(2,2-difluoropent-4-enyl)-3-(1-iodoethylidene)-2-methylidenethiophene |
| SMILES | C=CCC(F)(F)Cc1c/c(=C(/C)I)c(=C)s1 |
| InChI | InChI=1S/C12H13F2IS/c1-4-5-12(13,14)7-10-6-11(8(2)15)9(3)16-10/h4,6H,1,3,5,7H2,2H3/b11-8+ |
| InChIKey | FAKXSWDSFASUNU-DHZHZOJOSA-N |
| XLogP | 3.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-5-(2,2-difluoropent-4-enyl)-3-(1-iodoethylidene)-2-methylidenethiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-5-(2,2-difluoropent-4-enyl)-3-(1-iodoethylidene)-2-methylidenethiophene?
The IUPAC name of (3E)-5-(2,2-difluoropent-4-enyl)-3-(1-iodoethylidene)-2-methylidenethiophene (CID 134364774) is (3E)-5-(2,2-difluoropent-4-enyl)-3-(1-iodoethylidene)-2-methylidenethiophene.
What is the SMILES notation for (3E)-5-(2,2-difluoropent-4-enyl)-3-(1-iodoethylidene)-2-methylidenethiophene?
The canonical SMILES for (3E)-5-(2,2-difluoropent-4-enyl)-3-(1-iodoethylidene)-2-methylidenethiophene is C=CCC(F)(F)Cc1c/c(=C(/C)I)c(=C)s1.
What is the InChIKey of (3E)-5-(2,2-difluoropent-4-enyl)-3-(1-iodoethylidene)-2-methylidenethiophene?
The InChIKey is FAKXSWDSFASUNU-DHZHZOJOSA-N. The full InChI is InChI=1S/C12H13F2IS/c1-4-5-12(13,14)7-10-6-11(8(2)15)9(3)16-10/h4,6H,1,3,5,7H2,2H3/b11-8+.
What are the key properties of (3E)-5-(2,2-difluoropent-4-enyl)-3-(1-iodoethylidene)-2-methylidenethiophene?
(3E)-5-(2,2-difluoropent-4-enyl)-3-(1-iodoethylidene)-2-methylidenethiophene has a molecular weight of 354.20 g/mol, XLogP of 3.48, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-5-(2,2-difluoropent-4-enyl)-3-(1-iodoethylidene)-2-methylidenethiophene is sourced from PubChem (CID 134364774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).