C20H19ClF3N5S2 — CID 134364776
4-[(3aR,7aS)-6-[(6-chloro-3-pyridinyl)methyl]-3,3a,4,5,7,7a-hexahydro-[1,2]thiazolo[5,4-c]pyridin-2-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine (PubChem CID 134364776) has the molecular formula C20H19ClF3N5S2 and a molecular weight of 485.99 g/mol. Its IUPAC name is 4-[(3aR,7aS)-6-[(6-chloro-3-pyridinyl)methyl]-3,3a,4,5,7,7a-hexahydro-[1,2]thiazolo[5,4-c]pyridin-2-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-[(3aR,7aS)-6-[(6-chloro-3-pyridinyl)methyl]-3,3a,4,5,7,7a-hexahydro-[1,2]thiazolo[5,4-c]pyridin-2-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 134364776 |
| Molecular Formula | C20H19ClF3N5S2 |
| Molecular Weight | 485.99 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | 4-[(3aR,7aS)-6-[(6-chloro-3-pyridinyl)methyl]-3,3a,4,5,7,7a-hexahydro-[1,2]thiazolo[5,4-c]pyridin-2-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine |
| SMILES | FC(F)(F)Cc1cc2c(N3C[C@H]4CCN(Cc5ccc(Cl)nc5)C[C@H]4S3)ncnc2s1 |
| InChI | InChI=1S/C20H19ClF3N5S2/c21-17-2-1-12(7-25-17)8-28-4-3-13-9-29(31-16(13)10-28)18-15-5-14(6-20(22,23)24)30-19(15)27-11-26-18/h1-2,5,7,11,13,16H,3-4,6,8-10H2/t13-,16-/m1/s1 |
| InChIKey | JMCRMHGSAXGOGE-CZUORRHYSA-N |
| XLogP | 5.20 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.99 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|