C27H40N2 — CID 134364888
N-[(5E,7E,11Z,13Z)-4-propan-2-ylidene-5-[(Z)-prop-1-enyl]heptadeca-5,7,11,13-tetraen-2-ylidene]-N'-prop-1-en-2-ylmethanimidamide (PubChem CID 134364888) has the molecular formula C27H40N2 and a molecular weight of 392.63 g/mol. Its IUPAC name is N-[(5E,7E,11Z,13Z)-4-propan-2-ylidene-5-[(Z)-prop-1-enyl]heptadeca-5,7,11,13-tetraen-2-ylidene]-N'-prop-1-en-2-ylmethanimidamide.
| Compound Name | N-[(5E,7E,11Z,13Z)-4-propan-2-ylidene-5-[(Z)-prop-1-enyl]heptadeca-5,7,11,13-tetraen-2-ylidene]-N'-prop-1-en-2-ylmethanimidamide |
|---|---|
| PubChem CID | 134364888 |
| Molecular Formula | C27H40N2 |
| Molecular Weight | 392.63 g/mol |
| Exact Mass | 392.32 |
| IUPAC Name | N-[(5E,7E,11Z,13Z)-4-propan-2-ylidene-5-[(Z)-prop-1-enyl]heptadeca-5,7,11,13-tetraen-2-ylidene]-N'-prop-1-en-2-ylmethanimidamide |
| SMILES | C=C(C)/N=C/N=C(\C)CC(=C(C)C)C(/C=C\C)=C/C=C/CC/C=C\C=C/CCC |
| InChI | InChI=1S/C27H40N2/c1-8-10-11-12-13-14-15-16-17-18-20-26(19-9-2)27(23(3)4)21-25(7)29-22-28-24(5)6/h9,11-14,17-20,22H,5,8,10,15-16,21H2,1-4,6-7H3/b12-11-,14-13-,18-17+,19-9-,26-20+,28-22+,29-25+ |
| InChIKey | PJZGUKVWALYNJV-YNLGAOTBSA-N |
| XLogP | 8.49 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.63 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|