C24H40N2 — CID 134365026
N-[(3Z,5Z)-5-ethylidene-6-propyldeca-1,3-dien-2-yl]-N'-[(1Z)-2-ethyl-3-methylbuta-1,3-dienyl]ethanimidamide (PubChem CID 134365026) has the molecular formula C24H40N2 and a molecular weight of 356.60 g/mol. Its IUPAC name is N-[(3Z,5Z)-5-ethylidene-6-propyldeca-1,3-dien-2-yl]-N'-[(1Z)-2-ethyl-3-methylbuta-1,3-dienyl]ethanimidamide.
| Compound Name | N-[(3Z,5Z)-5-ethylidene-6-propyldeca-1,3-dien-2-yl]-N'-[(1Z)-2-ethyl-3-methylbuta-1,3-dienyl]ethanimidamide |
|---|---|
| PubChem CID | 134365026 |
| Molecular Formula | C24H40N2 |
| Molecular Weight | 356.60 g/mol |
| Exact Mass | 356.32 |
| IUPAC Name | N-[(3Z,5Z)-5-ethylidene-6-propyldeca-1,3-dien-2-yl]-N'-[(1Z)-2-ethyl-3-methylbuta-1,3-dienyl]ethanimidamide |
| SMILES | C=C(/C=C\C(=C/C)C(CCC)CCCC)N/C(C)=N/C=C(/CC)C(=C)C |
| InChI | InChI=1S/C24H40N2/c1-9-13-15-24(14-10-2)22(11-3)17-16-20(7)26-21(8)25-18-23(12-4)19(5)6/h11,16-18,24H,5,7,9-10,12-15H2,1-4,6,8H3,(H,25,26)/b17-16-,22-11+,23-18- |
| InChIKey | GBFBHCVROPUAJS-KEMZRIMQSA-N |
| XLogP | 7.49 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.60 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|