C10H9BrF5NO — CID 134365098
2-(2-bromoethyl)-5-(2,2,3,3,3-pentafluoropropoxy)pyridine (PubChem CID 134365098) has the molecular formula C10H9BrF5NO and a molecular weight of 334.08 g/mol. Its IUPAC name is 2-(2-bromoethyl)-5-(2,2,3,3,3-pentafluoropropoxy)pyridine.
| Compound Name | 2-(2-bromoethyl)-5-(2,2,3,3,3-pentafluoropropoxy)pyridine |
|---|---|
| PubChem CID | 134365098 |
| Molecular Formula | C10H9BrF5NO |
| Molecular Weight | 334.08 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | 2-(2-bromoethyl)-5-(2,2,3,3,3-pentafluoropropoxy)pyridine |
| SMILES | FC(F)(F)C(F)(F)COc1ccc(CCBr)nc1 |
| InChI | InChI=1S/C10H9BrF5NO/c11-4-3-7-1-2-8(5-17-7)18-6-9(12,13)10(14,15)16/h1-2,5H,3-4,6H2 |
| InChIKey | TXSTZENGEKEDOS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.08 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|