C16H10F5NOS — CID 134365106
2-(1-benzothiophen-2-yl)-5-(2,2,3,3,3-pentafluoropropoxy)pyridine (PubChem CID 134365106) has the molecular formula C16H10F5NOS and a molecular weight of 359.32 g/mol. Its IUPAC name is 2-(1-benzothiophen-2-yl)-5-(2,2,3,3,3-pentafluoropropoxy)pyridine.
| Compound Name | 2-(1-benzothiophen-2-yl)-5-(2,2,3,3,3-pentafluoropropoxy)pyridine |
|---|---|
| PubChem CID | 134365106 |
| Molecular Formula | C16H10F5NOS |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | 2-(1-benzothiophen-2-yl)-5-(2,2,3,3,3-pentafluoropropoxy)pyridine |
| SMILES | FC(F)(F)C(F)(F)COc1ccc(-c2cc3ccccc3s2)nc1 |
| InChI | InChI=1S/C16H10F5NOS/c17-15(18,16(19,20)21)9-23-11-5-6-12(22-8-11)14-7-10-3-1-2-4-13(10)24-14/h1-8H,9H2 |
| InChIKey | XTSAZLRXIVPRFH-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|