C18H14F5NOS2 — CID 134365161
2-(3-ethylsulfanyl-1-benzothiophen-2-yl)-5-(2,2,3,3,3-pentafluoropropoxy)pyridine (PubChem CID 134365161) has the molecular formula C18H14F5NOS2 and a molecular weight of 419.44 g/mol. Its IUPAC name is 2-(3-ethylsulfanyl-1-benzothiophen-2-yl)-5-(2,2,3,3,3-pentafluoropropoxy)pyridine.
| Compound Name | 2-(3-ethylsulfanyl-1-benzothiophen-2-yl)-5-(2,2,3,3,3-pentafluoropropoxy)pyridine |
|---|---|
| PubChem CID | 134365161 |
| Molecular Formula | C18H14F5NOS2 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | 2-(3-ethylsulfanyl-1-benzothiophen-2-yl)-5-(2,2,3,3,3-pentafluoropropoxy)pyridine |
| SMILES | CCSc1c(-c2ccc(OCC(F)(F)C(F)(F)F)cn2)sc2ccccc12 |
| InChI | InChI=1S/C18H14F5NOS2/c1-2-26-15-12-5-3-4-6-14(12)27-16(15)13-8-7-11(9-24-13)25-10-17(19,20)18(21,22)23/h3-9H,2,10H2,1H3 |
| InChIKey | DAWDHNVQCWNNTB-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|