C42H26N4O — CID 134365347
10-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-phenylnaphtho[2,1-g][1,3]benzoxazole (PubChem CID 134365347) has the molecular formula C42H26N4O and a molecular weight of 602.70 g/mol. Its IUPAC name is 10-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-phenylnaphtho[2,1-g][1,3]benzoxazole.
| Compound Name | 10-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-phenylnaphtho[2,1-g][1,3]benzoxazole |
|---|---|
| PubChem CID | 134365347 |
| Molecular Formula | C42H26N4O |
| Molecular Weight | 602.70 g/mol |
| Exact Mass | 602.21 |
| IUPAC Name | 10-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-phenylnaphtho[2,1-g][1,3]benzoxazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4ccc5ccc6ccc7nc(-c8ccccc8)oc7c6c5c4)c3)n2)cc1 |
| InChI | InChI=1S/C42H26N4O/c1-4-11-29(12-5-1)39-44-40(30-13-6-2-7-14-30)46-41(45-39)34-18-10-17-32(25-34)33-22-20-27-19-21-28-23-24-36-38(37(28)35(27)26-33)47-42(43-36)31-15-8-3-9-16-31/h1-26H |
| InChIKey | QAMHOZCHUAKQNB-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.70 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|