About 5-fluoro-2,3-dimethylcyclohepta-1,3,5-triene
5-fluoro-2,3-dimethylcyclohepta-1,3,5-triene (PubChem CID 134365600) has the molecular formula C9H11F
and a molecular weight of 138.18 g/mol. Its IUPAC name is 5-fluoro-2,3-dimethylcyclohepta-1,3,5-triene.
Molecular Properties
| Compound Name | 5-fluoro-2,3-dimethylcyclohepta-1,3,5-triene |
| PubChem CID | 134365600 |
| Molecular Formula | C9H11F |
| Molecular Weight | 138.18 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 5-fluoro-2,3-dimethylcyclohepta-1,3,5-triene |
| SMILES | CC1=CCC=C(F)C=C1C |
| InChI | InChI=1S/C9H11F/c1-7-4-3-5-9(10)6-8(7)2/h4-6H,3H2,1-2H3 |
| InChIKey | IGFXDWAVQAFYAM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.18 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-fluoro-2,3-dimethylcyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2,3-dimethylcyclohepta-1,3,5-triene?
The IUPAC name of 5-fluoro-2,3-dimethylcyclohepta-1,3,5-triene (CID 134365600) is 5-fluoro-2,3-dimethylcyclohepta-1,3,5-triene.
What is the SMILES notation for 5-fluoro-2,3-dimethylcyclohepta-1,3,5-triene?
The canonical SMILES for 5-fluoro-2,3-dimethylcyclohepta-1,3,5-triene is CC1=CCC=C(F)C=C1C.
What is the InChIKey of 5-fluoro-2,3-dimethylcyclohepta-1,3,5-triene?
The InChIKey is IGFXDWAVQAFYAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F/c1-7-4-3-5-9(10)6-8(7)2/h4-6H,3H2,1-2H3.
What are the key properties of 5-fluoro-2,3-dimethylcyclohepta-1,3,5-triene?
5-fluoro-2,3-dimethylcyclohepta-1,3,5-triene has a molecular weight of 138.18 g/mol, XLogP of 3.14, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2,3-dimethylcyclohepta-1,3,5-triene is sourced from PubChem (CID 134365600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).