C13H22FN — CID 134365607
4-[(3E,5E)-6-fluorohepta-3,5-dien-3-yl]-1-methylpiperidine (PubChem CID 134365607) has the molecular formula C13H22FN and a molecular weight of 211.32 g/mol. Its IUPAC name is 4-[(3E,5E)-6-fluorohepta-3,5-dien-3-yl]-1-methylpiperidine.
| Compound Name | 4-[(3E,5E)-6-fluorohepta-3,5-dien-3-yl]-1-methylpiperidine |
|---|---|
| PubChem CID | 134365607 |
| Molecular Formula | C13H22FN |
| Molecular Weight | 211.32 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 4-[(3E,5E)-6-fluorohepta-3,5-dien-3-yl]-1-methylpiperidine |
| SMILES | CC/C(=C\C=C(/C)F)C1CCN(C)CC1 |
| InChI | InChI=1S/C13H22FN/c1-4-12(6-5-11(2)14)13-7-9-15(3)10-8-13/h5-6,13H,4,7-10H2,1-3H3/b11-5+,12-6+ |
| InChIKey | NRRVNVMIMHAKIP-YDWXAUTNSA-N |
| XLogP | 3.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|