C14H19FIN — CID 134365611
(3R)-3-(5-fluorocyclohepta-1,3,4,6-tetraen-1-yl)-N-iodo-N-methylhexan-1-amine (PubChem CID 134365611) has the molecular formula C14H19FIN and a molecular weight of 347.22 g/mol. Its IUPAC name is (3R)-3-(5-fluorocyclohepta-1,3,4,6-tetraen-1-yl)-N-iodo-N-methylhexan-1-amine.
| Compound Name | (3R)-3-(5-fluorocyclohepta-1,3,4,6-tetraen-1-yl)-N-iodo-N-methylhexan-1-amine |
|---|---|
| PubChem CID | 134365611 |
| Molecular Formula | C14H19FIN |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | (3R)-3-(5-fluorocyclohepta-1,3,4,6-tetraen-1-yl)-N-iodo-N-methylhexan-1-amine |
| SMILES | CCC[C@H](CCN(C)I)C1=CC=C=C(F)C=C1 |
| InChI | InChI=1S/C14H19FIN/c1-3-5-12(10-11-17(2)16)13-6-4-7-14(15)9-8-13/h4,6,8-9,12H,3,5,10-11H2,1-2H3/t12-/m1/s1 |
| InChIKey | MTTUQHZZCNRQMO-GFCCVEGCSA-N |
| XLogP | 4.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|