About 4-[(2E,4E)-5-fluoropenta-2,4-dien-2-yl]piperidin-1-amine
4-[(2E,4E)-5-fluoropenta-2,4-dien-2-yl]piperidin-1-amine (PubChem CID 134365634) has the molecular formula C10H17FN2
and a molecular weight of 184.26 g/mol. Its IUPAC name is 4-[(2E,4E)-5-fluoropenta-2,4-dien-2-yl]piperidin-1-amine.
Molecular Properties
| Compound Name | 4-[(2E,4E)-5-fluoropenta-2,4-dien-2-yl]piperidin-1-amine |
| PubChem CID | 134365634 |
| Molecular Formula | C10H17FN2 |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.14 |
| IUPAC Name | 4-[(2E,4E)-5-fluoropenta-2,4-dien-2-yl]piperidin-1-amine |
| SMILES | C/C(=C\C=C\F)C1CCN(N)CC1 |
| InChI | InChI=1S/C10H17FN2/c1-9(3-2-6-11)10-4-7-13(12)8-5-10/h2-3,6,10H,4-5,7-8,12H2,1H3/b6-2+,9-3+ |
| InChIKey | HFTHITGBQNSQCB-YGQDEOHPSA-N |
| XLogP | 2.00 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2E,4E)-5-fluoropenta-2,4-dien-2-yl]piperidin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2E,4E)-5-fluoropenta-2,4-dien-2-yl]piperidin-1-amine?
The IUPAC name of 4-[(2E,4E)-5-fluoropenta-2,4-dien-2-yl]piperidin-1-amine (CID 134365634) is 4-[(2E,4E)-5-fluoropenta-2,4-dien-2-yl]piperidin-1-amine.
What is the SMILES notation for 4-[(2E,4E)-5-fluoropenta-2,4-dien-2-yl]piperidin-1-amine?
The canonical SMILES for 4-[(2E,4E)-5-fluoropenta-2,4-dien-2-yl]piperidin-1-amine is C/C(=C\C=C\F)C1CCN(N)CC1.
What is the InChIKey of 4-[(2E,4E)-5-fluoropenta-2,4-dien-2-yl]piperidin-1-amine?
The InChIKey is HFTHITGBQNSQCB-YGQDEOHPSA-N. The full InChI is InChI=1S/C10H17FN2/c1-9(3-2-6-11)10-4-7-13(12)8-5-10/h2-3,6,10H,4-5,7-8,12H2,1H3/b6-2+,9-3+.
What are the key properties of 4-[(2E,4E)-5-fluoropenta-2,4-dien-2-yl]piperidin-1-amine?
4-[(2E,4E)-5-fluoropenta-2,4-dien-2-yl]piperidin-1-amine has a molecular weight of 184.26 g/mol, XLogP of 2.00, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2E,4E)-5-fluoropenta-2,4-dien-2-yl]piperidin-1-amine is sourced from PubChem (CID 134365634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).