C8H14FN — CID 134365643
(2E,4E)-5-fluoro-N,3-dimethylhexa-2,4-dien-2-amine (PubChem CID 134365643) has the molecular formula C8H14FN and a molecular weight of 143.20 g/mol. Its IUPAC name is (2E,4E)-5-fluoro-N,3-dimethylhexa-2,4-dien-2-amine.
| Compound Name | (2E,4E)-5-fluoro-N,3-dimethylhexa-2,4-dien-2-amine |
|---|---|
| PubChem CID | 134365643 |
| Molecular Formula | C8H14FN |
| Molecular Weight | 143.20 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | (2E,4E)-5-fluoro-N,3-dimethylhexa-2,4-dien-2-amine |
| SMILES | CN/C(C)=C(C)/C=C(\C)F |
| InChI | InChI=1S/C8H14FN/c1-6(5-7(2)9)8(3)10-4/h5,10H,1-4H3/b7-5+,8-6+ |
| InChIKey | ZQNMMVJMBCHSQW-KQQUZDAGSA-N |
| XLogP | 2.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.20 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|