C9H13F2N — CID 134365647
(3Z,5E)-5,8-difluoro-N-methylocta-1,3,5-trien-2-amine (PubChem CID 134365647) has the molecular formula C9H13F2N and a molecular weight of 173.21 g/mol. Its IUPAC name is (3Z,5E)-5,8-difluoro-N-methylocta-1,3,5-trien-2-amine.
| Compound Name | (3Z,5E)-5,8-difluoro-N-methylocta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 134365647 |
| Molecular Formula | C9H13F2N |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | (3Z,5E)-5,8-difluoro-N-methylocta-1,3,5-trien-2-amine |
| SMILES | C=C(/C=C\C(F)=C/CCF)NC |
| InChI | InChI=1S/C9H13F2N/c1-8(12-2)5-6-9(11)4-3-7-10/h4-6,12H,1,3,7H2,2H3/b6-5-,9-4+ |
| InChIKey | OEGKWDDWPFLFPX-CXBDEZGUSA-N |
| XLogP | 2.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|