About (Z)-N,N-dimethyl-2-(1-methyl-2,3-dihydroazepin-7-yl)ethenamine
(Z)-N,N-dimethyl-2-(1-methyl-2,3-dihydroazepin-7-yl)ethenamine (PubChem CID 134365652) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is (Z)-N,N-dimethyl-2-(1-methyl-2,3-dihydroazepin-7-yl)ethenamine.
Molecular Properties
| Compound Name | (Z)-N,N-dimethyl-2-(1-methyl-2,3-dihydroazepin-7-yl)ethenamine |
| PubChem CID | 134365652 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (Z)-N,N-dimethyl-2-(1-methyl-2,3-dihydroazepin-7-yl)ethenamine |
| SMILES | CN(C)/C=C\C1=CC=CCCN1C |
| InChI | InChI=1S/C11H18N2/c1-12(2)10-8-11-7-5-4-6-9-13(11)3/h4-5,7-8,10H,6,9H2,1-3H3/b10-8- |
| InChIKey | QMSBTJBRZGDCSL-NTMALXAHSA-N |
| XLogP | 1.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-N,N-dimethyl-2-(1-methyl-2,3-dihydroazepin-7-yl)ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N,N-dimethyl-2-(1-methyl-2,3-dihydroazepin-7-yl)ethenamine?
The IUPAC name of (Z)-N,N-dimethyl-2-(1-methyl-2,3-dihydroazepin-7-yl)ethenamine (CID 134365652) is (Z)-N,N-dimethyl-2-(1-methyl-2,3-dihydroazepin-7-yl)ethenamine.
What is the SMILES notation for (Z)-N,N-dimethyl-2-(1-methyl-2,3-dihydroazepin-7-yl)ethenamine?
The canonical SMILES for (Z)-N,N-dimethyl-2-(1-methyl-2,3-dihydroazepin-7-yl)ethenamine is CN(C)/C=C\C1=CC=CCCN1C.
What is the InChIKey of (Z)-N,N-dimethyl-2-(1-methyl-2,3-dihydroazepin-7-yl)ethenamine?
The InChIKey is QMSBTJBRZGDCSL-NTMALXAHSA-N. The full InChI is InChI=1S/C11H18N2/c1-12(2)10-8-11-7-5-4-6-9-13(11)3/h4-5,7-8,10H,6,9H2,1-3H3/b10-8-.
What are the key properties of (Z)-N,N-dimethyl-2-(1-methyl-2,3-dihydroazepin-7-yl)ethenamine?
(Z)-N,N-dimethyl-2-(1-methyl-2,3-dihydroazepin-7-yl)ethenamine has a molecular weight of 178.28 g/mol, XLogP of 1.84, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,N-dimethyl-2-(1-methyl-2,3-dihydroazepin-7-yl)ethenamine is sourced from PubChem (CID 134365652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).