About 4-(4-fluorocyclohepta-1,3,5-trien-1-yl)-1-methylpiperidine
4-(4-fluorocyclohepta-1,3,5-trien-1-yl)-1-methylpiperidine (PubChem CID 134365673) has the molecular formula C13H18FN
and a molecular weight of 207.29 g/mol. Its IUPAC name is 4-(4-fluorocyclohepta-1,3,5-trien-1-yl)-1-methylpiperidine.
Molecular Properties
| Compound Name | 4-(4-fluorocyclohepta-1,3,5-trien-1-yl)-1-methylpiperidine |
| PubChem CID | 134365673 |
| Molecular Formula | C13H18FN |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 4-(4-fluorocyclohepta-1,3,5-trien-1-yl)-1-methylpiperidine |
| SMILES | CN1CCC(C2=CC=C(F)C=CC2)CC1 |
| InChI | InChI=1S/C13H18FN/c1-15-9-7-12(8-10-15)11-3-2-4-13(14)6-5-11/h2,4-6,12H,3,7-10H2,1H3 |
| InChIKey | ASFNPPPFXTWFGF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(4-fluorocyclohepta-1,3,5-trien-1-yl)-1-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluorocyclohepta-1,3,5-trien-1-yl)-1-methylpiperidine?
The IUPAC name of 4-(4-fluorocyclohepta-1,3,5-trien-1-yl)-1-methylpiperidine (CID 134365673) is 4-(4-fluorocyclohepta-1,3,5-trien-1-yl)-1-methylpiperidine.
What is the SMILES notation for 4-(4-fluorocyclohepta-1,3,5-trien-1-yl)-1-methylpiperidine?
The canonical SMILES for 4-(4-fluorocyclohepta-1,3,5-trien-1-yl)-1-methylpiperidine is CN1CCC(C2=CC=C(F)C=CC2)CC1.
What is the InChIKey of 4-(4-fluorocyclohepta-1,3,5-trien-1-yl)-1-methylpiperidine?
The InChIKey is ASFNPPPFXTWFGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18FN/c1-15-9-7-12(8-10-15)11-3-2-4-13(14)6-5-11/h2,4-6,12H,3,7-10H2,1H3.
What are the key properties of 4-(4-fluorocyclohepta-1,3,5-trien-1-yl)-1-methylpiperidine?
4-(4-fluorocyclohepta-1,3,5-trien-1-yl)-1-methylpiperidine has a molecular weight of 207.29 g/mol, XLogP of 3.07, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluorocyclohepta-1,3,5-trien-1-yl)-1-methylpiperidine is sourced from PubChem (CID 134365673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).