About (Z,7S)-N-ethyl-7-fluoro-N,3-dimethyl-4-methylidenenon-5-en-1-amine
(Z,7S)-N-ethyl-7-fluoro-N,3-dimethyl-4-methylidenenon-5-en-1-amine (PubChem CID 134365675) has the molecular formula C14H26FN
and a molecular weight of 227.37 g/mol. Its IUPAC name is (Z,7S)-N-ethyl-7-fluoro-N,3-dimethyl-4-methylidenenon-5-en-1-amine.
Molecular Properties
| Compound Name | (Z,7S)-N-ethyl-7-fluoro-N,3-dimethyl-4-methylidenenon-5-en-1-amine |
| PubChem CID | 134365675 |
| Molecular Formula | C14H26FN |
| Molecular Weight | 227.37 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | (Z,7S)-N-ethyl-7-fluoro-N,3-dimethyl-4-methylidenenon-5-en-1-amine |
| SMILES | C=C(/C=C\[C@@H](F)CC)C(C)CCN(C)CC |
| InChI | InChI=1S/C14H26FN/c1-6-14(15)9-8-12(3)13(4)10-11-16(5)7-2/h8-9,13-14H,3,6-7,10-11H2,1-2,4-5H3/b9-8-/t13?,14-/m0/s1 |
| InChIKey | XZQLWWDVKCUSIJ-BITNCPOMSA-N |
| XLogP | 3.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z,7S)-N-ethyl-7-fluoro-N,3-dimethyl-4-methylidenenon-5-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,7S)-N-ethyl-7-fluoro-N,3-dimethyl-4-methylidenenon-5-en-1-amine?
The IUPAC name of (Z,7S)-N-ethyl-7-fluoro-N,3-dimethyl-4-methylidenenon-5-en-1-amine (CID 134365675) is (Z,7S)-N-ethyl-7-fluoro-N,3-dimethyl-4-methylidenenon-5-en-1-amine.
What is the SMILES notation for (Z,7S)-N-ethyl-7-fluoro-N,3-dimethyl-4-methylidenenon-5-en-1-amine?
The canonical SMILES for (Z,7S)-N-ethyl-7-fluoro-N,3-dimethyl-4-methylidenenon-5-en-1-amine is C=C(/C=C\[C@@H](F)CC)C(C)CCN(C)CC.
What is the InChIKey of (Z,7S)-N-ethyl-7-fluoro-N,3-dimethyl-4-methylidenenon-5-en-1-amine?
The InChIKey is XZQLWWDVKCUSIJ-BITNCPOMSA-N. The full InChI is InChI=1S/C14H26FN/c1-6-14(15)9-8-12(3)13(4)10-11-16(5)7-2/h8-9,13-14H,3,6-7,10-11H2,1-2,4-5H3/b9-8-/t13?,14-/m0/s1.
What are the key properties of (Z,7S)-N-ethyl-7-fluoro-N,3-dimethyl-4-methylidenenon-5-en-1-amine?
(Z,7S)-N-ethyl-7-fluoro-N,3-dimethyl-4-methylidenenon-5-en-1-amine has a molecular weight of 227.37 g/mol, XLogP of 3.82, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,7S)-N-ethyl-7-fluoro-N,3-dimethyl-4-methylidenenon-5-en-1-amine is sourced from PubChem (CID 134365675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).