C14H24FN — CID 134365702
4-[(3Z)-5-fluoroocta-1,3-dien-2-yl]-1-methylpiperidine (PubChem CID 134365702) has the molecular formula C14H24FN and a molecular weight of 225.35 g/mol. Its IUPAC name is 4-[(3Z)-5-fluoroocta-1,3-dien-2-yl]-1-methylpiperidine.
| Compound Name | 4-[(3Z)-5-fluoroocta-1,3-dien-2-yl]-1-methylpiperidine |
|---|---|
| PubChem CID | 134365702 |
| Molecular Formula | C14H24FN |
| Molecular Weight | 225.35 g/mol |
| Exact Mass | 225.19 |
| IUPAC Name | 4-[(3Z)-5-fluoroocta-1,3-dien-2-yl]-1-methylpiperidine |
| SMILES | C=C(/C=C\C(F)CCC)C1CCN(C)CC1 |
| InChI | InChI=1S/C14H24FN/c1-4-5-14(15)7-6-12(2)13-8-10-16(3)11-9-13/h6-7,13-14H,2,4-5,8-11H2,1,3H3/b7-6- |
| InChIKey | LEVDLTNCBMALCX-SREVYHEPSA-N |
| XLogP | 3.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|