C9H15NO — CID 134365773
(2Z,4E)-4-methoxy-N-methylhepta-2,4,6-trien-1-amine (PubChem CID 134365773) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (2Z,4E)-4-methoxy-N-methylhepta-2,4,6-trien-1-amine.
| Compound Name | (2Z,4E)-4-methoxy-N-methylhepta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 134365773 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (2Z,4E)-4-methoxy-N-methylhepta-2,4,6-trien-1-amine |
| SMILES | C=C/C=C(\C=C/CNC)OC |
| InChI | InChI=1S/C9H15NO/c1-4-6-9(11-3)7-5-8-10-2/h4-7,10H,1,8H2,2-3H3/b7-5-,9-6+ |
| InChIKey | BZDNSEHIJCPIQT-XCZNYUDNSA-N |
| XLogP | 1.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|