C9H15F2N — CID 134365775
(3Z,5Z)-4,7-difluoro-N-methylocta-3,5-dien-3-amine (PubChem CID 134365775) has the molecular formula C9H15F2N and a molecular weight of 175.22 g/mol. Its IUPAC name is (3Z,5Z)-4,7-difluoro-N-methylocta-3,5-dien-3-amine.
| Compound Name | (3Z,5Z)-4,7-difluoro-N-methylocta-3,5-dien-3-amine |
|---|---|
| PubChem CID | 134365775 |
| Molecular Formula | C9H15F2N |
| Molecular Weight | 175.22 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | (3Z,5Z)-4,7-difluoro-N-methylocta-3,5-dien-3-amine |
| SMILES | CC/C(NC)=C(F)\C=C/C(C)F |
| InChI | InChI=1S/C9H15F2N/c1-4-9(12-3)8(11)6-5-7(2)10/h5-7,12H,4H2,1-3H3/b6-5-,9-8- |
| InChIKey | LNUIFMYZFDCGAM-AFJQJTPPSA-N |
| XLogP | 2.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.22 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|