C14H22FN — CID 134365789
4-[(3Z,5Z)-7-fluoroocta-3,5,7-trien-4-yl]-1-methylpiperidine (PubChem CID 134365789) has the molecular formula C14H22FN and a molecular weight of 223.33 g/mol. Its IUPAC name is 4-[(3Z,5Z)-7-fluoroocta-3,5,7-trien-4-yl]-1-methylpiperidine.
| Compound Name | 4-[(3Z,5Z)-7-fluoroocta-3,5,7-trien-4-yl]-1-methylpiperidine |
|---|---|
| PubChem CID | 134365789 |
| Molecular Formula | C14H22FN |
| Molecular Weight | 223.33 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 4-[(3Z,5Z)-7-fluoroocta-3,5,7-trien-4-yl]-1-methylpiperidine |
| SMILES | C=C(F)/C=C\C(=C/CC)C1CCN(C)CC1 |
| InChI | InChI=1S/C14H22FN/c1-4-5-13(7-6-12(2)15)14-8-10-16(3)11-9-14/h5-7,14H,2,4,8-11H2,1,3H3/b7-6-,13-5+ |
| InChIKey | DNVRNTPCJVYSRI-ZQNRWWJISA-N |
| XLogP | 3.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|