C16H33N — CID 134365887
3-ethenyl-5-ethyl-N,3,4,4,5-pentamethylheptan-2-amine (PubChem CID 134365887) has the molecular formula C16H33N and a molecular weight of 239.45 g/mol. Its IUPAC name is 3-ethenyl-5-ethyl-N,3,4,4,5-pentamethylheptan-2-amine.
| Compound Name | 3-ethenyl-5-ethyl-N,3,4,4,5-pentamethylheptan-2-amine |
|---|---|
| PubChem CID | 134365887 |
| Molecular Formula | C16H33N |
| Molecular Weight | 239.45 g/mol |
| Exact Mass | 239.26 |
| IUPAC Name | 3-ethenyl-5-ethyl-N,3,4,4,5-pentamethylheptan-2-amine |
| SMILES | C=CC(C)(C(C)NC)C(C)(C)C(C)(CC)CC |
| InChI | InChI=1S/C16H33N/c1-10-15(7,11-2)14(5,6)16(8,12-3)13(4)17-9/h12-13,17H,3,10-11H2,1-2,4-9H3 |
| InChIKey | ZAKGQLDPRNERMN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|