C8H18FO12P3 — CID 134366243
[[(2R,3S)-2-(fluoromethyl)-3-hydroxy-2-methoxyhex-5-enoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 134366243) has the molecular formula C8H18FO12P3 and a molecular weight of 418.14 g/mol. Its IUPAC name is [[(2R,3S)-2-(fluoromethyl)-3-hydroxy-2-methoxyhex-5-enoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S)-2-(fluoromethyl)-3-hydroxy-2-methoxyhex-5-enoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 134366243 |
| Molecular Formula | C8H18FO12P3 |
| Molecular Weight | 418.14 g/mol |
| Exact Mass | 418.00 |
| IUPAC Name | [[(2R,3S)-2-(fluoromethyl)-3-hydroxy-2-methoxyhex-5-enoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C=CC[C@H](O)[C@@](CF)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)OC |
| InChI | InChI=1S/C8H18FO12P3/c1-3-4-7(10)8(5-9,18-2)6-19-23(14,15)21-24(16,17)20-22(11,12)13/h3,7,10H,1,4-6H2,2H3,(H,14,15)(H,16,17)(H2,11,12,13)/t7-,8+/m0/s1 |
| InChIKey | HROROZWHFMKMRU-JGVFFNPUSA-N |
| XLogP | 0.62 |
| TPSA | 189.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.14 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|