C13H20N2O — CID 134369157
4-tert-butyl-5-methyl-1,3,5,6-tetrahydroquinoxalin-2-one (PubChem CID 134369157) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 4-tert-butyl-5-methyl-1,3,5,6-tetrahydroquinoxalin-2-one.
| Compound Name | 4-tert-butyl-5-methyl-1,3,5,6-tetrahydroquinoxalin-2-one |
|---|---|
| PubChem CID | 134369157 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 4-tert-butyl-5-methyl-1,3,5,6-tetrahydroquinoxalin-2-one |
| SMILES | CC1CC=CC2=C1N(C(C)(C)C)CC(=O)N2 |
| InChI | InChI=1S/C13H20N2O/c1-9-6-5-7-10-12(9)15(13(2,3)4)8-11(16)14-10/h5,7,9H,6,8H2,1-4H3,(H,14,16) |
| InChIKey | HDTKWDHZQXBFJG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |