About (2S)-2,3-dimethyl-1,2-dihydrobenzimidazole
(2S)-2,3-dimethyl-1,2-dihydrobenzimidazole (PubChem CID 134369206) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is (2S)-2,3-dimethyl-1,2-dihydrobenzimidazole.
Molecular Properties
| Compound Name | (2S)-2,3-dimethyl-1,2-dihydrobenzimidazole |
| PubChem CID | 134369206 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | (2S)-2,3-dimethyl-1,2-dihydrobenzimidazole |
| SMILES | C[C@H]1Nc2ccccc2N1C |
| InChI | InChI=1S/C9H12N2/c1-7-10-8-5-3-4-6-9(8)11(7)2/h3-7,10H,1-2H3/t7-/m0/s1 |
| InChIKey | VSJKGWNZJOGGMH-ZETCQYMHSA-N |
| XLogP | 1.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2,3-dimethyl-1,2-dihydrobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,3-dimethyl-1,2-dihydrobenzimidazole?
The IUPAC name of (2S)-2,3-dimethyl-1,2-dihydrobenzimidazole (CID 134369206) is (2S)-2,3-dimethyl-1,2-dihydrobenzimidazole.
What is the SMILES notation for (2S)-2,3-dimethyl-1,2-dihydrobenzimidazole?
The canonical SMILES for (2S)-2,3-dimethyl-1,2-dihydrobenzimidazole is C[C@H]1Nc2ccccc2N1C.
What is the InChIKey of (2S)-2,3-dimethyl-1,2-dihydrobenzimidazole?
The InChIKey is VSJKGWNZJOGGMH-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H12N2/c1-7-10-8-5-3-4-6-9(8)11(7)2/h3-7,10H,1-2H3/t7-/m0/s1.
What are the key properties of (2S)-2,3-dimethyl-1,2-dihydrobenzimidazole?
(2S)-2,3-dimethyl-1,2-dihydrobenzimidazole has a molecular weight of 148.21 g/mol, XLogP of 1.89, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,3-dimethyl-1,2-dihydrobenzimidazole is sourced from PubChem (CID 134369206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).