C13H22N2O — CID 134369378
3-[(3E)-hexa-1,3,5-trien-3-yl]-1,1-di(propan-2-yl)urea (PubChem CID 134369378) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 3-[(3E)-hexa-1,3,5-trien-3-yl]-1,1-di(propan-2-yl)urea.
| Compound Name | 3-[(3E)-hexa-1,3,5-trien-3-yl]-1,1-di(propan-2-yl)urea |
|---|---|
| PubChem CID | 134369378 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 3-[(3E)-hexa-1,3,5-trien-3-yl]-1,1-di(propan-2-yl)urea |
| SMILES | C=C/C=C(\C=C)NC(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C13H22N2O/c1-7-9-12(8-2)14-13(16)15(10(3)4)11(5)6/h7-11H,1-2H2,3-6H3,(H,14,16)/b12-9+ |
| InChIKey | OYCPDMYQLRBCIG-FMIVXFBMSA-N |
| XLogP | 3.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|