About [2-(hydroxymethyl)-5-methyl-2,5-dihydrofuran-3-yl] acetate
[2-(hydroxymethyl)-5-methyl-2,5-dihydrofuran-3-yl] acetate (PubChem CID 134369422) has the molecular formula C8H12O4
and a molecular weight of 172.18 g/mol. Its IUPAC name is [2-(hydroxymethyl)-5-methyl-2,5-dihydrofuran-3-yl] acetate.
Molecular Properties
| Compound Name | [2-(hydroxymethyl)-5-methyl-2,5-dihydrofuran-3-yl] acetate |
| PubChem CID | 134369422 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | [2-(hydroxymethyl)-5-methyl-2,5-dihydrofuran-3-yl] acetate |
| SMILES | CC(=O)OC1=CC(C)OC1CO |
| InChI | InChI=1S/C8H12O4/c1-5-3-7(12-6(2)10)8(4-9)11-5/h3,5,8-9H,4H2,1-2H3 |
| InChIKey | ZQYLYORCGZUTKP-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(hydroxymethyl)-5-methyl-2,5-dihydrofuran-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(hydroxymethyl)-5-methyl-2,5-dihydrofuran-3-yl] acetate?
The IUPAC name of [2-(hydroxymethyl)-5-methyl-2,5-dihydrofuran-3-yl] acetate (CID 134369422) is [2-(hydroxymethyl)-5-methyl-2,5-dihydrofuran-3-yl] acetate.
What is the SMILES notation for [2-(hydroxymethyl)-5-methyl-2,5-dihydrofuran-3-yl] acetate?
The canonical SMILES for [2-(hydroxymethyl)-5-methyl-2,5-dihydrofuran-3-yl] acetate is CC(=O)OC1=CC(C)OC1CO.
What is the InChIKey of [2-(hydroxymethyl)-5-methyl-2,5-dihydrofuran-3-yl] acetate?
The InChIKey is ZQYLYORCGZUTKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O4/c1-5-3-7(12-6(2)10)8(4-9)11-5/h3,5,8-9H,4H2,1-2H3.
What are the key properties of [2-(hydroxymethyl)-5-methyl-2,5-dihydrofuran-3-yl] acetate?
[2-(hydroxymethyl)-5-methyl-2,5-dihydrofuran-3-yl] acetate has a molecular weight of 172.18 g/mol, XLogP of 0.21, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(hydroxymethyl)-5-methyl-2,5-dihydrofuran-3-yl] acetate is sourced from PubChem (CID 134369422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).