C34H31F2N5O8 — CID 134370189
2-(2,7-difluoro-3-hydroxy-6-methylidenexanthen-9-yl)-5-[[1-[2-hydroxy-3-(2-nitroimidazol-1-yl)propyl]piperidin-4-yl]methylcarbamoyl]benzoic acid (PubChem CID 134370189) has the molecular formula C34H31F2N5O8 and a molecular weight of 675.65 g/mol. Its IUPAC name is 2-(2,7-difluoro-3-hydroxy-6-methylidenexanthen-9-yl)-5-[[1-[2-hydroxy-3-(2-nitroimidazol-1-yl)propyl]piperidin-4-yl]methylcarbamoyl]benzoic acid.
| Compound Name | 2-(2,7-difluoro-3-hydroxy-6-methylidenexanthen-9-yl)-5-[[1-[2-hydroxy-3-(2-nitroimidazol-1-yl)propyl]piperidin-4-yl]methylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 134370189 |
| Molecular Formula | C34H31F2N5O8 |
| Molecular Weight | 675.65 g/mol |
| Exact Mass | 675.21 |
| IUPAC Name | 2-(2,7-difluoro-3-hydroxy-6-methylidenexanthen-9-yl)-5-[[1-[2-hydroxy-3-(2-nitroimidazol-1-yl)propyl]piperidin-4-yl]methylcarbamoyl]benzoic acid |
| SMILES | C=c1cc2c(cc1F)=C(c1ccc(C(=O)NCC3CCN(CC(O)Cn4ccnc4[N+](=O)[O-])CC3)cc1C(=O)O)c1cc(F)c(O)cc1O2 |
| InChI | InChI=1S/C34H31F2N5O8/c1-18-10-29-24(12-26(18)35)31(25-13-27(36)28(43)14-30(25)49-29)22-3-2-20(11-23(22)33(45)46)32(44)38-15-19-4-7-39(8-5-19)16-21(42)17-40-9-6-37-34(40)41(47)48/h2-3,6,9-14,19,21,42-43H,1,4-5,7-8,15-17H2,(H,38,44)(H,45,46) |
| InChIKey | QLNVARLNAAVCGY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 180.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.65 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|