C27H29ClN2O3 — CID 134370531
5-(3-chlorophenyl)-2-(4-methoxy-2-propan-2-yloxyphenyl)-4-(4-methylphenyl)imidazolidine-1-carbaldehyde (PubChem CID 134370531) has the molecular formula C27H29ClN2O3 and a molecular weight of 464.99 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-2-(4-methoxy-2-propan-2-yloxyphenyl)-4-(4-methylphenyl)imidazolidine-1-carbaldehyde.
| Compound Name | 5-(3-chlorophenyl)-2-(4-methoxy-2-propan-2-yloxyphenyl)-4-(4-methylphenyl)imidazolidine-1-carbaldehyde |
|---|---|
| PubChem CID | 134370531 |
| Molecular Formula | C27H29ClN2O3 |
| Molecular Weight | 464.99 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 5-(3-chlorophenyl)-2-(4-methoxy-2-propan-2-yloxyphenyl)-4-(4-methylphenyl)imidazolidine-1-carbaldehyde |
| SMILES | COc1ccc(C2NC(c3ccc(C)cc3)C(c3cccc(Cl)c3)N2C=O)c(OC(C)C)c1 |
| InChI | InChI=1S/C27H29ClN2O3/c1-17(2)33-24-15-22(32-4)12-13-23(24)27-29-25(19-10-8-18(3)9-11-19)26(30(27)16-31)20-6-5-7-21(28)14-20/h5-17,25-27,29H,1-4H3 |
| InChIKey | VICOZZUDBQMAIS-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.99 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|