C22H19F3N2 — CID 134371440
12,13,13,17-tetramethyl-12-(trifluoromethyl)-9,19-diazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(17),2,4,6,8,10,14(18),15-octaene (PubChem CID 134371440) has the molecular formula C22H19F3N2 and a molecular weight of 368.40 g/mol. Its IUPAC name is 12,13,13,17-tetramethyl-12-(trifluoromethyl)-9,19-diazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(17),2,4,6,8,10,14(18),15-octaene.
| Compound Name | 12,13,13,17-tetramethyl-12-(trifluoromethyl)-9,19-diazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(17),2,4,6,8,10,14(18),15-octaene |
|---|---|
| PubChem CID | 134371440 |
| Molecular Formula | C22H19F3N2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 12,13,13,17-tetramethyl-12-(trifluoromethyl)-9,19-diazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(17),2,4,6,8,10,14(18),15-octaene |
| SMILES | Cc1ccc2c3c1c1ccccc1c1ncc(n13)C(C)(C(F)(F)F)C2(C)C |
| InChI | InChI=1S/C22H19F3N2/c1-12-9-10-15-18-17(12)13-7-5-6-8-14(13)19-26-11-16(27(18)19)21(4,20(15,2)3)22(23,24)25/h5-11H,1-4H3 |
| InChIKey | BAFYVODPFOQHEU-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|