C19H31N — CID 134371648
(3E,5E,7Z)-5,8,9-trimethyl-N-(2-methylbutan-2-yl)undeca-3,5,7,9,10-pentaen-1-amine (PubChem CID 134371648) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is (3E,5E,7Z)-5,8,9-trimethyl-N-(2-methylbutan-2-yl)undeca-3,5,7,9,10-pentaen-1-amine.
| Compound Name | (3E,5E,7Z)-5,8,9-trimethyl-N-(2-methylbutan-2-yl)undeca-3,5,7,9,10-pentaen-1-amine |
|---|---|
| PubChem CID | 134371648 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | (3E,5E,7Z)-5,8,9-trimethyl-N-(2-methylbutan-2-yl)undeca-3,5,7,9,10-pentaen-1-amine |
| SMILES | C=C=C(C)/C(C)=C\C=C(C)\C=C\CCNC(C)(C)CC |
| InChI | InChI=1S/C19H31N/c1-8-17(4)18(5)14-13-16(3)12-10-11-15-20-19(6,7)9-2/h10,12-14,20H,1,9,11,15H2,2-7H3/b12-10+,16-13+,18-14- |
| InChIKey | RKAGIYHVDMBOIB-VOTKAGPZSA-N |
| XLogP | 5.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|