About (3Z)-5-hydroxy-6-methyl-2-propan-2-ylidenehepta-3,5-dienenitrile
(3Z)-5-hydroxy-6-methyl-2-propan-2-ylidenehepta-3,5-dienenitrile (PubChem CID 134372053) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is (3Z)-5-hydroxy-6-methyl-2-propan-2-ylidenehepta-3,5-dienenitrile.
Molecular Properties
| Compound Name | (3Z)-5-hydroxy-6-methyl-2-propan-2-ylidenehepta-3,5-dienenitrile |
| PubChem CID | 134372053 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (3Z)-5-hydroxy-6-methyl-2-propan-2-ylidenehepta-3,5-dienenitrile |
| SMILES | CC(C)=C(O)/C=C\C(C#N)=C(C)C |
| InChI | InChI=1S/C11H15NO/c1-8(2)10(7-12)5-6-11(13)9(3)4/h5-6,13H,1-4H3/b6-5- |
| InChIKey | YQOBGVBCUCJVIT-WAYWQWQTSA-N |
| XLogP | 3.25 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-5-hydroxy-6-methyl-2-propan-2-ylidenehepta-3,5-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-5-hydroxy-6-methyl-2-propan-2-ylidenehepta-3,5-dienenitrile?
The IUPAC name of (3Z)-5-hydroxy-6-methyl-2-propan-2-ylidenehepta-3,5-dienenitrile (CID 134372053) is (3Z)-5-hydroxy-6-methyl-2-propan-2-ylidenehepta-3,5-dienenitrile.
What is the SMILES notation for (3Z)-5-hydroxy-6-methyl-2-propan-2-ylidenehepta-3,5-dienenitrile?
The canonical SMILES for (3Z)-5-hydroxy-6-methyl-2-propan-2-ylidenehepta-3,5-dienenitrile is CC(C)=C(O)/C=C\C(C#N)=C(C)C.
What is the InChIKey of (3Z)-5-hydroxy-6-methyl-2-propan-2-ylidenehepta-3,5-dienenitrile?
The InChIKey is YQOBGVBCUCJVIT-WAYWQWQTSA-N. The full InChI is InChI=1S/C11H15NO/c1-8(2)10(7-12)5-6-11(13)9(3)4/h5-6,13H,1-4H3/b6-5-.
What are the key properties of (3Z)-5-hydroxy-6-methyl-2-propan-2-ylidenehepta-3,5-dienenitrile?
(3Z)-5-hydroxy-6-methyl-2-propan-2-ylidenehepta-3,5-dienenitrile has a molecular weight of 177.25 g/mol, XLogP of 3.25, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-5-hydroxy-6-methyl-2-propan-2-ylidenehepta-3,5-dienenitrile is sourced from PubChem (CID 134372053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).