C29H33F5N6O4S2 — CID 134372713
1-[2-[2-fluoro-4-[2-(2,3,5,6-tetrafluorophenyl)propan-2-ylsulfonyl]phenyl]sulfanyl-5-methoxy-4-[(5-methyl-1H-pyrazol-3-yl)amino]-1,2,5,6-tetrahydropyrimidin-6-yl]piperidin-4-ol (PubChem CID 134372713) has the molecular formula C29H33F5N6O4S2 and a molecular weight of 688.75 g/mol. Its IUPAC name is 1-[2-[2-fluoro-4-[2-(2,3,5,6-tetrafluorophenyl)propan-2-ylsulfonyl]phenyl]sulfanyl-5-methoxy-4-[(5-methyl-1H-pyrazol-3-yl)amino]-1,2,5,6-tetrahydropyrimidin-6-yl]piperidin-4-ol.
| Compound Name | 1-[2-[2-fluoro-4-[2-(2,3,5,6-tetrafluorophenyl)propan-2-ylsulfonyl]phenyl]sulfanyl-5-methoxy-4-[(5-methyl-1H-pyrazol-3-yl)amino]-1,2,5,6-tetrahydropyrimidin-6-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 134372713 |
| Molecular Formula | C29H33F5N6O4S2 |
| Molecular Weight | 688.75 g/mol |
| Exact Mass | 688.19 |
| IUPAC Name | 1-[2-[2-fluoro-4-[2-(2,3,5,6-tetrafluorophenyl)propan-2-ylsulfonyl]phenyl]sulfanyl-5-methoxy-4-[(5-methyl-1H-pyrazol-3-yl)amino]-1,2,5,6-tetrahydropyrimidin-6-yl]piperidin-4-ol |
| SMILES | COC1C(Nc2cc(C)[nH]n2)=NC(Sc2ccc(S(=O)(=O)C(C)(C)c3c(F)c(F)cc(F)c3F)cc2F)NC1N1CCC(O)CC1 |
| InChI | InChI=1S/C29H33F5N6O4S2/c1-14-11-21(39-38-14)35-26-25(44-4)27(40-9-7-15(41)8-10-40)37-28(36-26)45-20-6-5-16(12-17(20)30)46(42,43)29(2,3)22-23(33)18(31)13-19(32)24(22)34/h5-6,11-13,15,25,27-28,37,41H,7-10H2,1-4H3,(H2,35,36,38,39) |
| InChIKey | WANORNUYCQXUKX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 131.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.75 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|