C41H24N4O8 — CID 134372814
2-[5-(2-methyl-1,3-dioxoisoindol-5-yl)-1,3-dioxoisoindol-2-yl]-6-[4-[(4-methylphenyl)methyl]phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 134372814) has the molecular formula C41H24N4O8 and a molecular weight of 700.66 g/mol. Its IUPAC name is 2-[5-(2-methyl-1,3-dioxoisoindol-5-yl)-1,3-dioxoisoindol-2-yl]-6-[4-[(4-methylphenyl)methyl]phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2-[5-(2-methyl-1,3-dioxoisoindol-5-yl)-1,3-dioxoisoindol-2-yl]-6-[4-[(4-methylphenyl)methyl]phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 134372814 |
| Molecular Formula | C41H24N4O8 |
| Molecular Weight | 700.66 g/mol |
| Exact Mass | 700.16 |
| IUPAC Name | 2-[5-(2-methyl-1,3-dioxoisoindol-5-yl)-1,3-dioxoisoindol-2-yl]-6-[4-[(4-methylphenyl)methyl]phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | Cc1ccc(Cc2ccc(-n3c(=O)c4cc5c(=O)n(N6C(=O)c7ccc(-c8ccc9c(c8)C(=O)N(C)C9=O)cc7C6=O)c(=O)c5cc4c3=O)cc2)cc1 |
| InChI | InChI=1S/C41H24N4O8/c1-20-3-5-21(6-4-20)15-22-7-11-25(12-8-22)43-36(48)30-18-32-33(19-31(30)37(43)49)41(53)45(40(32)52)44-38(50)27-14-10-24(17-29(27)39(44)51)23-9-13-26-28(16-23)35(47)42(2)34(26)46/h3-14,16-19H,15H2,1-2H3 |
| InChIKey | HJDRLFDRBSLLPK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 152.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.66 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|