C26H45N — CID 134372893
2-[(1R,3R,5E,7E,9R,10S,15S)-10-ethyl-3,7,9,15-tetramethyl-4,12-dimethylidenecyclohexadeca-5,7-dien-1-yl]ethanamine (PubChem CID 134372893) has the molecular formula C26H45N and a molecular weight of 371.65 g/mol. Its IUPAC name is 2-[(1R,3R,5E,7E,9R,10S,15S)-10-ethyl-3,7,9,15-tetramethyl-4,12-dimethylidenecyclohexadeca-5,7-dien-1-yl]ethanamine.
| Compound Name | 2-[(1R,3R,5E,7E,9R,10S,15S)-10-ethyl-3,7,9,15-tetramethyl-4,12-dimethylidenecyclohexadeca-5,7-dien-1-yl]ethanamine |
|---|---|
| PubChem CID | 134372893 |
| Molecular Formula | C26H45N |
| Molecular Weight | 371.65 g/mol |
| Exact Mass | 371.36 |
| IUPAC Name | 2-[(1R,3R,5E,7E,9R,10S,15S)-10-ethyl-3,7,9,15-tetramethyl-4,12-dimethylidenecyclohexadeca-5,7-dien-1-yl]ethanamine |
| SMILES | C=C1CC[C@H](C)C[C@@H](CCN)C[C@@H](C)C(=C)/C=C/C(C)=C/[C@H](C)[C@@H](CC)C1 |
| InChI | InChI=1S/C26H45N/c1-8-26-17-21(4)10-9-20(3)16-25(13-14-27)18-23(6)22(5)12-11-19(2)15-24(26)7/h11-12,15,20,23-26H,4-5,8-10,13-14,16-18,27H2,1-3,6-7H3/b12-11+,19-15+/t20-,23+,24-,25+,26-/m0/s1 |
| InChIKey | WNLUVASNXPDCDP-KIWAVSGKSA-N |
| XLogP | 7.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.65 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|