About 9-fluoro-8-methylundec-10-en-4,6-diyn-1-ol
9-fluoro-8-methylundec-10-en-4,6-diyn-1-ol (PubChem CID 134372969) has the molecular formula C12H15FO
and a molecular weight of 194.25 g/mol. Its IUPAC name is 9-fluoro-8-methylundec-10-en-4,6-diyn-1-ol.
Molecular Properties
| Compound Name | 9-fluoro-8-methylundec-10-en-4,6-diyn-1-ol |
| PubChem CID | 134372969 |
| Molecular Formula | C12H15FO |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 9-fluoro-8-methylundec-10-en-4,6-diyn-1-ol |
| SMILES | C=CC(F)C(C)C#CC#CCCCO |
| InChI | InChI=1S/C12H15FO/c1-3-12(13)11(2)9-7-5-4-6-8-10-14/h3,11-12,14H,1,6,8,10H2,2H3 |
| InChIKey | NBTPDNABEYTCMH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-fluoro-8-methylundec-10-en-4,6-diyn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-fluoro-8-methylundec-10-en-4,6-diyn-1-ol?
The IUPAC name of 9-fluoro-8-methylundec-10-en-4,6-diyn-1-ol (CID 134372969) is 9-fluoro-8-methylundec-10-en-4,6-diyn-1-ol.
What is the SMILES notation for 9-fluoro-8-methylundec-10-en-4,6-diyn-1-ol?
The canonical SMILES for 9-fluoro-8-methylundec-10-en-4,6-diyn-1-ol is C=CC(F)C(C)C#CC#CCCCO.
What is the InChIKey of 9-fluoro-8-methylundec-10-en-4,6-diyn-1-ol?
The InChIKey is NBTPDNABEYTCMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15FO/c1-3-12(13)11(2)9-7-5-4-6-8-10-14/h3,11-12,14H,1,6,8,10H2,2H3.
What are the key properties of 9-fluoro-8-methylundec-10-en-4,6-diyn-1-ol?
9-fluoro-8-methylundec-10-en-4,6-diyn-1-ol has a molecular weight of 194.25 g/mol, XLogP of 1.93, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-fluoro-8-methylundec-10-en-4,6-diyn-1-ol is sourced from PubChem (CID 134372969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).