About 2-(2-amino-1,3-thiazol-4-yl)benzene-1,4-diol
2-(2-amino-1,3-thiazol-4-yl)benzene-1,4-diol (PubChem CID 13437302) has the molecular formula C9H8N2O2S
and a molecular weight of 208.24 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)benzene-1,4-diol.
Molecular Properties
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)benzene-1,4-diol |
| PubChem CID | 13437302 |
| Molecular Formula | C9H8N2O2S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)benzene-1,4-diol |
| SMILES | Nc1nc(-c2cc(O)ccc2O)cs1 |
| InChI | InChI=1S/C9H8N2O2S/c10-9-11-7(4-14-9)6-3-5(12)1-2-8(6)13/h1-4,12-13H,(H2,10,11) |
| InChIKey | FQIPDEKYQCURKU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-amino-1,3-thiazol-4-yl)benzene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-1,3-thiazol-4-yl)benzene-1,4-diol?
The IUPAC name of 2-(2-amino-1,3-thiazol-4-yl)benzene-1,4-diol (CID 13437302) is 2-(2-amino-1,3-thiazol-4-yl)benzene-1,4-diol.
What is the SMILES notation for 2-(2-amino-1,3-thiazol-4-yl)benzene-1,4-diol?
The canonical SMILES for 2-(2-amino-1,3-thiazol-4-yl)benzene-1,4-diol is Nc1nc(-c2cc(O)ccc2O)cs1.
What is the InChIKey of 2-(2-amino-1,3-thiazol-4-yl)benzene-1,4-diol?
The InChIKey is FQIPDEKYQCURKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2S/c10-9-11-7(4-14-9)6-3-5(12)1-2-8(6)13/h1-4,12-13H,(H2,10,11).
What are the key properties of 2-(2-amino-1,3-thiazol-4-yl)benzene-1,4-diol?
2-(2-amino-1,3-thiazol-4-yl)benzene-1,4-diol has a molecular weight of 208.24 g/mol, XLogP of 1.80, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-1,3-thiazol-4-yl)benzene-1,4-diol is sourced from PubChem (CID 13437302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).