About 1-(5-chloro-1H-indazol-7-yl)-2-(1-ethylsulfonylpiperidin-4-yl)-2,2-difluoroethanol
1-(5-chloro-1H-indazol-7-yl)-2-(1-ethylsulfonylpiperidin-4-yl)-2,2-difluoroethanol (PubChem CID 134373282) has the molecular formula C16H20ClF2N3O3S
and a molecular weight of 407.87 g/mol. Its IUPAC name is 1-(5-chloro-1H-indazol-7-yl)-2-(1-ethylsulfonylpiperidin-4-yl)-2,2-difluoroethanol.
Molecular Properties
| Compound Name | 1-(5-chloro-1H-indazol-7-yl)-2-(1-ethylsulfonylpiperidin-4-yl)-2,2-difluoroethanol |
| PubChem CID | 134373282 |
| Molecular Formula | C16H20ClF2N3O3S |
| Molecular Weight | 407.87 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 1-(5-chloro-1H-indazol-7-yl)-2-(1-ethylsulfonylpiperidin-4-yl)-2,2-difluoroethanol |
| SMILES | CCS(=O)(=O)N1CCC(C(F)(F)C(O)c2cc(Cl)cc3cn[nH]c23)CC1 |
| InChI | InChI=1S/C16H20ClF2N3O3S/c1-2-26(24,25)22-5-3-11(4-6-22)16(18,19)15(23)13-8-12(17)7-10-9-20-21-14(10)13/h7-9,11,15,23H,2-6H2,1H3,(H,20,21) |
| InChIKey | SSECIQPJAOFIRF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.87 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5-chloro-1H-indazol-7-yl)-2-(1-ethylsulfonylpiperidin-4-yl)-2,2-difluoroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-chloro-1H-indazol-7-yl)-2-(1-ethylsulfonylpiperidin-4-yl)-2,2-difluoroethanol?
The IUPAC name of 1-(5-chloro-1H-indazol-7-yl)-2-(1-ethylsulfonylpiperidin-4-yl)-2,2-difluoroethanol (CID 134373282) is 1-(5-chloro-1H-indazol-7-yl)-2-(1-ethylsulfonylpiperidin-4-yl)-2,2-difluoroethanol.
What is the SMILES notation for 1-(5-chloro-1H-indazol-7-yl)-2-(1-ethylsulfonylpiperidin-4-yl)-2,2-difluoroethanol?
The canonical SMILES for 1-(5-chloro-1H-indazol-7-yl)-2-(1-ethylsulfonylpiperidin-4-yl)-2,2-difluoroethanol is CCS(=O)(=O)N1CCC(C(F)(F)C(O)c2cc(Cl)cc3cn[nH]c23)CC1.
What is the InChIKey of 1-(5-chloro-1H-indazol-7-yl)-2-(1-ethylsulfonylpiperidin-4-yl)-2,2-difluoroethanol?
The InChIKey is SSECIQPJAOFIRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20ClF2N3O3S/c1-2-26(24,25)22-5-3-11(4-6-22)16(18,19)15(23)13-8-12(17)7-10-9-20-21-14(10)13/h7-9,11,15,23H,2-6H2,1H3,(H,20,21).
What are the key properties of 1-(5-chloro-1H-indazol-7-yl)-2-(1-ethylsulfonylpiperidin-4-yl)-2,2-difluoroethanol?
1-(5-chloro-1H-indazol-7-yl)-2-(1-ethylsulfonylpiperidin-4-yl)-2,2-difluoroethanol has a molecular weight of 407.87 g/mol, XLogP of 2.95, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-chloro-1H-indazol-7-yl)-2-(1-ethylsulfonylpiperidin-4-yl)-2,2-difluoroethanol is sourced from PubChem (CID 134373282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).