C21H20Cl2F2N4O2 — CID 134373302
1-[4-[2-(5-chloro-1H-indazol-7-yl)-1,1-difluoro-2-hydroxyethyl]piperidin-1-yl]-2-(2-chloro-4-pyridinyl)ethanone (PubChem CID 134373302) has the molecular formula C21H20Cl2F2N4O2 and a molecular weight of 469.32 g/mol. Its IUPAC name is 1-[4-[2-(5-chloro-1H-indazol-7-yl)-1,1-difluoro-2-hydroxyethyl]piperidin-1-yl]-2-(2-chloro-4-pyridinyl)ethanone.
| Compound Name | 1-[4-[2-(5-chloro-1H-indazol-7-yl)-1,1-difluoro-2-hydroxyethyl]piperidin-1-yl]-2-(2-chloro-4-pyridinyl)ethanone |
|---|---|
| PubChem CID | 134373302 |
| Molecular Formula | C21H20Cl2F2N4O2 |
| Molecular Weight | 469.32 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 1-[4-[2-(5-chloro-1H-indazol-7-yl)-1,1-difluoro-2-hydroxyethyl]piperidin-1-yl]-2-(2-chloro-4-pyridinyl)ethanone |
| SMILES | O=C(Cc1ccnc(Cl)c1)N1CCC(C(F)(F)C(O)c2cc(Cl)cc3cn[nH]c23)CC1 |
| InChI | InChI=1S/C21H20Cl2F2N4O2/c22-15-9-13-11-27-28-19(13)16(10-15)20(31)21(24,25)14-2-5-29(6-3-14)18(30)8-12-1-4-26-17(23)7-12/h1,4,7,9-11,14,20,31H,2-3,5-6,8H2,(H,27,28) |
| InChIKey | KIOAOTVBBFKBOK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.32 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|