About (5-chloro-4,6-difluoro-1H-indazol-7-yl)-cyclobutylmethanol
(5-chloro-4,6-difluoro-1H-indazol-7-yl)-cyclobutylmethanol (PubChem CID 134373727) has the molecular formula C12H11ClF2N2O
and a molecular weight of 272.68 g/mol. Its IUPAC name is (5-chloro-4,6-difluoro-1H-indazol-7-yl)-cyclobutylmethanol.
Molecular Properties
| Compound Name | (5-chloro-4,6-difluoro-1H-indazol-7-yl)-cyclobutylmethanol |
| PubChem CID | 134373727 |
| Molecular Formula | C12H11ClF2N2O |
| Molecular Weight | 272.68 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | (5-chloro-4,6-difluoro-1H-indazol-7-yl)-cyclobutylmethanol |
| SMILES | OC(c1c(F)c(Cl)c(F)c2cn[nH]c12)C1CCC1 |
| InChI | InChI=1S/C12H11ClF2N2O/c13-8-9(14)6-4-16-17-11(6)7(10(8)15)12(18)5-2-1-3-5/h4-5,12,18H,1-3H2,(H,16,17) |
| InChIKey | WGUFMQYORAPZMJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.68 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze (5-chloro-4,6-difluoro-1H-indazol-7-yl)-cyclobutylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-4,6-difluoro-1H-indazol-7-yl)-cyclobutylmethanol?
The IUPAC name of (5-chloro-4,6-difluoro-1H-indazol-7-yl)-cyclobutylmethanol (CID 134373727) is (5-chloro-4,6-difluoro-1H-indazol-7-yl)-cyclobutylmethanol.
What is the SMILES notation for (5-chloro-4,6-difluoro-1H-indazol-7-yl)-cyclobutylmethanol?
The canonical SMILES for (5-chloro-4,6-difluoro-1H-indazol-7-yl)-cyclobutylmethanol is OC(c1c(F)c(Cl)c(F)c2cn[nH]c12)C1CCC1.
What is the InChIKey of (5-chloro-4,6-difluoro-1H-indazol-7-yl)-cyclobutylmethanol?
The InChIKey is WGUFMQYORAPZMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClF2N2O/c13-8-9(14)6-4-16-17-11(6)7(10(8)15)12(18)5-2-1-3-5/h4-5,12,18H,1-3H2,(H,16,17).
What are the key properties of (5-chloro-4,6-difluoro-1H-indazol-7-yl)-cyclobutylmethanol?
(5-chloro-4,6-difluoro-1H-indazol-7-yl)-cyclobutylmethanol has a molecular weight of 272.68 g/mol, XLogP of 3.33, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-4,6-difluoro-1H-indazol-7-yl)-cyclobutylmethanol is sourced from PubChem (CID 134373727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).