About 3-(benzenesulfonyl)-3-(5-methylidenecyclohepta-1,3,6-trien-1-yl)pyrrolidine
3-(benzenesulfonyl)-3-(5-methylidenecyclohepta-1,3,6-trien-1-yl)pyrrolidine (PubChem CID 134374206) has the molecular formula C18H19NO2S
and a molecular weight of 313.42 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-3-(5-methylidenecyclohepta-1,3,6-trien-1-yl)pyrrolidine.
Molecular Properties
| Compound Name | 3-(benzenesulfonyl)-3-(5-methylidenecyclohepta-1,3,6-trien-1-yl)pyrrolidine |
| PubChem CID | 134374206 |
| Molecular Formula | C18H19NO2S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 3-(benzenesulfonyl)-3-(5-methylidenecyclohepta-1,3,6-trien-1-yl)pyrrolidine |
| SMILES | C=C1C=CC=C(C2(S(=O)(=O)c3ccccc3)CCNC2)C=C1 |
| InChI | InChI=1S/C18H19NO2S/c1-15-6-5-7-16(11-10-15)18(12-13-19-14-18)22(20,21)17-8-3-2-4-9-17/h2-11,19H,1,12-14H2 |
| InChIKey | XBNTWQJQODDUOJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(benzenesulfonyl)-3-(5-methylidenecyclohepta-1,3,6-trien-1-yl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzenesulfonyl)-3-(5-methylidenecyclohepta-1,3,6-trien-1-yl)pyrrolidine?
The IUPAC name of 3-(benzenesulfonyl)-3-(5-methylidenecyclohepta-1,3,6-trien-1-yl)pyrrolidine (CID 134374206) is 3-(benzenesulfonyl)-3-(5-methylidenecyclohepta-1,3,6-trien-1-yl)pyrrolidine.
What is the SMILES notation for 3-(benzenesulfonyl)-3-(5-methylidenecyclohepta-1,3,6-trien-1-yl)pyrrolidine?
The canonical SMILES for 3-(benzenesulfonyl)-3-(5-methylidenecyclohepta-1,3,6-trien-1-yl)pyrrolidine is C=C1C=CC=C(C2(S(=O)(=O)c3ccccc3)CCNC2)C=C1.
What is the InChIKey of 3-(benzenesulfonyl)-3-(5-methylidenecyclohepta-1,3,6-trien-1-yl)pyrrolidine?
The InChIKey is XBNTWQJQODDUOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO2S/c1-15-6-5-7-16(11-10-15)18(12-13-19-14-18)22(20,21)17-8-3-2-4-9-17/h2-11,19H,1,12-14H2.
What are the key properties of 3-(benzenesulfonyl)-3-(5-methylidenecyclohepta-1,3,6-trien-1-yl)pyrrolidine?
3-(benzenesulfonyl)-3-(5-methylidenecyclohepta-1,3,6-trien-1-yl)pyrrolidine has a molecular weight of 313.42 g/mol, XLogP of 2.80, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzenesulfonyl)-3-(5-methylidenecyclohepta-1,3,6-trien-1-yl)pyrrolidine is sourced from PubChem (CID 134374206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).