C19H10F6OS — CID 134374860
4-[4-[(3,4-difluorophenoxy)-difluoromethyl]-3,5-difluorophenyl]benzenethiol (PubChem CID 134374860) has the molecular formula C19H10F6OS and a molecular weight of 400.34 g/mol. Its IUPAC name is 4-[4-[(3,4-difluorophenoxy)-difluoromethyl]-3,5-difluorophenyl]benzenethiol.
| Compound Name | 4-[4-[(3,4-difluorophenoxy)-difluoromethyl]-3,5-difluorophenyl]benzenethiol |
|---|---|
| PubChem CID | 134374860 |
| Molecular Formula | C19H10F6OS |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 4-[4-[(3,4-difluorophenoxy)-difluoromethyl]-3,5-difluorophenyl]benzenethiol |
| SMILES | Fc1ccc(OC(F)(F)c2c(F)cc(-c3ccc(S)cc3)cc2F)cc1F |
| InChI | InChI=1S/C19H10F6OS/c20-14-6-3-12(9-15(14)21)26-19(24,25)18-16(22)7-11(8-17(18)23)10-1-4-13(27)5-2-10/h1-9,27H |
| InChIKey | FQVOHILZUVAFCL-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|