C24H38F2O — CID 134374981
1-[(3Z,5E)-5-ethoxy-3,4-difluorohepta-1,3,5-trien-2-yl]-4-(4-propylcyclohexyl)cyclohexane (PubChem CID 134374981) has the molecular formula C24H38F2O and a molecular weight of 380.56 g/mol. Its IUPAC name is 1-[(3Z,5E)-5-ethoxy-3,4-difluorohepta-1,3,5-trien-2-yl]-4-(4-propylcyclohexyl)cyclohexane.
| Compound Name | 1-[(3Z,5E)-5-ethoxy-3,4-difluorohepta-1,3,5-trien-2-yl]-4-(4-propylcyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 134374981 |
| Molecular Formula | C24H38F2O |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | 1-[(3Z,5E)-5-ethoxy-3,4-difluorohepta-1,3,5-trien-2-yl]-4-(4-propylcyclohexyl)cyclohexane |
| SMILES | C=C(/C(F)=C(F)\C(=C/C)OCC)C1CCC(C2CCC(CCC)CC2)CC1 |
| InChI | InChI=1S/C24H38F2O/c1-5-8-18-9-11-20(12-10-18)21-15-13-19(14-16-21)17(4)23(25)24(26)22(6-2)27-7-3/h6,18-21H,4-5,7-16H2,1-3H3/b22-6+,24-23- |
| InChIKey | JGXZYMCBGZVUCT-YDSYTZAESA-N |
| XLogP | 8.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|