About (E)-5-ethyl-1-(2-fluoroethoxy)-2,6-dimethylhept-2-ene
(E)-5-ethyl-1-(2-fluoroethoxy)-2,6-dimethylhept-2-ene (PubChem CID 134375644) has the molecular formula C13H25FO
and a molecular weight of 216.34 g/mol. Its IUPAC name is (E)-5-ethyl-1-(2-fluoroethoxy)-2,6-dimethylhept-2-ene.
Molecular Properties
| Compound Name | (E)-5-ethyl-1-(2-fluoroethoxy)-2,6-dimethylhept-2-ene |
| PubChem CID | 134375644 |
| Molecular Formula | C13H25FO |
| Molecular Weight | 216.34 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | (E)-5-ethyl-1-(2-fluoroethoxy)-2,6-dimethylhept-2-ene |
| SMILES | CCC(C/C=C(\C)COCCF)C(C)C |
| InChI | InChI=1S/C13H25FO/c1-5-13(11(2)3)7-6-12(4)10-15-9-8-14/h6,11,13H,5,7-10H2,1-4H3/b12-6+ |
| InChIKey | MHUCYPSLLWADBR-WUXMJOGZSA-N |
| XLogP | 3.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-ethyl-1-(2-fluoroethoxy)-2,6-dimethylhept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-ethyl-1-(2-fluoroethoxy)-2,6-dimethylhept-2-ene?
The IUPAC name of (E)-5-ethyl-1-(2-fluoroethoxy)-2,6-dimethylhept-2-ene (CID 134375644) is (E)-5-ethyl-1-(2-fluoroethoxy)-2,6-dimethylhept-2-ene.
What is the SMILES notation for (E)-5-ethyl-1-(2-fluoroethoxy)-2,6-dimethylhept-2-ene?
The canonical SMILES for (E)-5-ethyl-1-(2-fluoroethoxy)-2,6-dimethylhept-2-ene is CCC(C/C=C(\C)COCCF)C(C)C.
What is the InChIKey of (E)-5-ethyl-1-(2-fluoroethoxy)-2,6-dimethylhept-2-ene?
The InChIKey is MHUCYPSLLWADBR-WUXMJOGZSA-N. The full InChI is InChI=1S/C13H25FO/c1-5-13(11(2)3)7-6-12(4)10-15-9-8-14/h6,11,13H,5,7-10H2,1-4H3/b12-6+.
What are the key properties of (E)-5-ethyl-1-(2-fluoroethoxy)-2,6-dimethylhept-2-ene?
(E)-5-ethyl-1-(2-fluoroethoxy)-2,6-dimethylhept-2-ene has a molecular weight of 216.34 g/mol, XLogP of 3.99, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-ethyl-1-(2-fluoroethoxy)-2,6-dimethylhept-2-ene is sourced from PubChem (CID 134375644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).