About N-(2-fluoroethyl)-N,1,4-trimethyl-4-propan-2-ylcyclohex-2-en-1-amine
N-(2-fluoroethyl)-N,1,4-trimethyl-4-propan-2-ylcyclohex-2-en-1-amine (PubChem CID 134375785) has the molecular formula C14H26FN
and a molecular weight of 227.37 g/mol. Its IUPAC name is N-(2-fluoroethyl)-N,1,4-trimethyl-4-propan-2-ylcyclohex-2-en-1-amine.
Molecular Properties
| Compound Name | N-(2-fluoroethyl)-N,1,4-trimethyl-4-propan-2-ylcyclohex-2-en-1-amine |
| PubChem CID | 134375785 |
| Molecular Formula | C14H26FN |
| Molecular Weight | 227.37 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | N-(2-fluoroethyl)-N,1,4-trimethyl-4-propan-2-ylcyclohex-2-en-1-amine |
| SMILES | CC(C)C1(C)C=CC(C)(N(C)CCF)CC1 |
| InChI | InChI=1S/C14H26FN/c1-12(2)13(3)6-8-14(4,9-7-13)16(5)11-10-15/h6,8,12H,7,9-11H2,1-5H3 |
| InChIKey | VAQHEWILJOJOHU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-fluoroethyl)-N,1,4-trimethyl-4-propan-2-ylcyclohex-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluoroethyl)-N,1,4-trimethyl-4-propan-2-ylcyclohex-2-en-1-amine?
The IUPAC name of N-(2-fluoroethyl)-N,1,4-trimethyl-4-propan-2-ylcyclohex-2-en-1-amine (CID 134375785) is N-(2-fluoroethyl)-N,1,4-trimethyl-4-propan-2-ylcyclohex-2-en-1-amine.
What is the SMILES notation for N-(2-fluoroethyl)-N,1,4-trimethyl-4-propan-2-ylcyclohex-2-en-1-amine?
The canonical SMILES for N-(2-fluoroethyl)-N,1,4-trimethyl-4-propan-2-ylcyclohex-2-en-1-amine is CC(C)C1(C)C=CC(C)(N(C)CCF)CC1.
What is the InChIKey of N-(2-fluoroethyl)-N,1,4-trimethyl-4-propan-2-ylcyclohex-2-en-1-amine?
The InChIKey is VAQHEWILJOJOHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26FN/c1-12(2)13(3)6-8-14(4,9-7-13)16(5)11-10-15/h6,8,12H,7,9-11H2,1-5H3.
What are the key properties of N-(2-fluoroethyl)-N,1,4-trimethyl-4-propan-2-ylcyclohex-2-en-1-amine?
N-(2-fluoroethyl)-N,1,4-trimethyl-4-propan-2-ylcyclohex-2-en-1-amine has a molecular weight of 227.37 g/mol, XLogP of 3.66, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluoroethyl)-N,1,4-trimethyl-4-propan-2-ylcyclohex-2-en-1-amine is sourced from PubChem (CID 134375785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).