C12H20FN — CID 134375788
(3Z,5E)-3-fluoro-N,N,6,7-tetramethylocta-1,3,5-trien-4-amine (PubChem CID 134375788) has the molecular formula C12H20FN and a molecular weight of 197.30 g/mol. Its IUPAC name is (3Z,5E)-3-fluoro-N,N,6,7-tetramethylocta-1,3,5-trien-4-amine.
| Compound Name | (3Z,5E)-3-fluoro-N,N,6,7-tetramethylocta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 134375788 |
| Molecular Formula | C12H20FN |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | (3Z,5E)-3-fluoro-N,N,6,7-tetramethylocta-1,3,5-trien-4-amine |
| SMILES | C=C/C(F)=C(\C=C(/C)C(C)C)N(C)C |
| InChI | InChI=1S/C12H20FN/c1-7-11(13)12(14(5)6)8-10(4)9(2)3/h7-9H,1H2,2-6H3/b10-8+,12-11- |
| InChIKey | OETBZFUOWSNBDD-GHGFDZLXSA-N |
| XLogP | 3.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|