C9H11ClN2 — CID 134375817
7-chloro-2-methyl-1,5,6,7-tetrahydropyrrolo[2,3-b]azepine (PubChem CID 134375817) has the molecular formula C9H11ClN2 and a molecular weight of 182.65 g/mol. Its IUPAC name is 7-chloro-2-methyl-1,5,6,7-tetrahydropyrrolo[2,3-b]azepine.
| Compound Name | 7-chloro-2-methyl-1,5,6,7-tetrahydropyrrolo[2,3-b]azepine |
|---|---|
| PubChem CID | 134375817 |
| Molecular Formula | C9H11ClN2 |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 7-chloro-2-methyl-1,5,6,7-tetrahydropyrrolo[2,3-b]azepine |
| SMILES | Cc1cc2c([nH]1)=NC(Cl)CCC=2 |
| InChI | InChI=1S/C9H11ClN2/c1-6-5-7-3-2-4-8(10)12-9(7)11-6/h3,5,8H,2,4H2,1H3,(H,11,12) |
| InChIKey | YSMLPPRVEWKAQY-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|