C17H16FN3 — CID 134375823
5-[2-(5,6-dihydro-1H-pyrrolo[2,3-b]pyridin-2-yl)ethynyl]-2-fluoro-N,N-dimethylaniline (PubChem CID 134375823) has the molecular formula C17H16FN3 and a molecular weight of 281.33 g/mol. Its IUPAC name is 5-[2-(5,6-dihydro-1H-pyrrolo[2,3-b]pyridin-2-yl)ethynyl]-2-fluoro-N,N-dimethylaniline.
| Compound Name | 5-[2-(5,6-dihydro-1H-pyrrolo[2,3-b]pyridin-2-yl)ethynyl]-2-fluoro-N,N-dimethylaniline |
|---|---|
| PubChem CID | 134375823 |
| Molecular Formula | C17H16FN3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 5-[2-(5,6-dihydro-1H-pyrrolo[2,3-b]pyridin-2-yl)ethynyl]-2-fluoro-N,N-dimethylaniline |
| SMILES | CN(C)c1cc(C#Cc2cc3c([nH]2)=NCCC=3)ccc1F |
| InChI | InChI=1S/C17H16FN3/c1-21(2)16-10-12(6-8-15(16)18)5-7-14-11-13-4-3-9-19-17(13)20-14/h4,6,8,10-11H,3,9H2,1-2H3,(H,19,20) |
| InChIKey | UZTDHYBEUZCMCJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 31.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|