About 2-methyl-2,3,5,6-tetrahydro-1H-pyrrolo[3,2-b]pyridine
2-methyl-2,3,5,6-tetrahydro-1H-pyrrolo[3,2-b]pyridine (PubChem CID 134375896) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 2-methyl-2,3,5,6-tetrahydro-1H-pyrrolo[3,2-b]pyridine.
Analyze 2-methyl-2,3,5,6-tetrahydro-1H-pyrrolo[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2,3,5,6-tetrahydro-1H-pyrrolo[3,2-b]pyridine?
The IUPAC name of 2-methyl-2,3,5,6-tetrahydro-1H-pyrrolo[3,2-b]pyridine (CID 134375896) is 2-methyl-2,3,5,6-tetrahydro-1H-pyrrolo[3,2-b]pyridine.
What is the SMILES notation for 2-methyl-2,3,5,6-tetrahydro-1H-pyrrolo[3,2-b]pyridine?
The canonical SMILES for 2-methyl-2,3,5,6-tetrahydro-1H-pyrrolo[3,2-b]pyridine is CC1CC2=NCCC=C2N1.
What is the InChIKey of 2-methyl-2,3,5,6-tetrahydro-1H-pyrrolo[3,2-b]pyridine?
The InChIKey is DTEMMKJUKMCYCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2/c1-6-5-8-7(10-6)3-2-4-9-8/h3,6,10H,2,4-5H2,1H3.
What are the key properties of 2-methyl-2,3,5,6-tetrahydro-1H-pyrrolo[3,2-b]pyridine?
2-methyl-2,3,5,6-tetrahydro-1H-pyrrolo[3,2-b]pyridine has a molecular weight of 136.20 g/mol, XLogP of 1.10, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2,3,5,6-tetrahydro-1H-pyrrolo[3,2-b]pyridine is sourced from PubChem (CID 134375896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).