About 6-fluoro-2-iodo-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine
6-fluoro-2-iodo-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine (PubChem CID 134376306) has the molecular formula C7H6FIN2
and a molecular weight of 264.04 g/mol. Its IUPAC name is 6-fluoro-2-iodo-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 6-fluoro-2-iodo-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 134376306 |
| Molecular Formula | C7H6FIN2 |
| Molecular Weight | 264.04 g/mol |
| Exact Mass | 263.96 |
| IUPAC Name | 6-fluoro-2-iodo-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine |
| SMILES | FC1CC=c2cc(I)[nH]c2=N1 |
| InChI | InChI=1S/C7H6FIN2/c8-5-2-1-4-3-6(9)11-7(4)10-5/h1,3,5H,2H2,(H,10,11) |
| InChIKey | RTTCMASIFVCWCP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.04 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-2-iodo-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2-iodo-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 6-fluoro-2-iodo-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine (CID 134376306) is 6-fluoro-2-iodo-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 6-fluoro-2-iodo-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 6-fluoro-2-iodo-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine is FC1CC=c2cc(I)[nH]c2=N1.
What is the InChIKey of 6-fluoro-2-iodo-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is RTTCMASIFVCWCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6FIN2/c8-5-2-1-4-3-6(9)11-7(4)10-5/h1,3,5H,2H2,(H,10,11).
What are the key properties of 6-fluoro-2-iodo-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine?
6-fluoro-2-iodo-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 264.04 g/mol, XLogP of 0.72, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2-iodo-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 134376306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).